C13H25NO — CID 142560297
(NE)-N-(2,3,3,5-tetramethylnon-1-en-4-ylidene)hydroxylamine (PubChem CID 142560297) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (NE)-N-(2,3,3,5-tetramethylnon-1-en-4-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(2,3,3,5-tetramethylnon-1-en-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 142560297 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (NE)-N-(2,3,3,5-tetramethylnon-1-en-4-ylidene)hydroxylamine |
| SMILES | C=C(C)C(C)(C)/C(=N/O)C(C)CCCC |
| InChI | InChI=1S/C13H25NO/c1-7-8-9-11(4)12(14-15)13(5,6)10(2)3/h11,15H,2,7-9H2,1,3-6H3/b14-12+ |
| InChIKey | RTLDVICFQLHCFN-WYMLVPIESA-N |
| XLogP | 4.25 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|