C21H46 — CID 178052039
ethane;2-methylnonane;2,3,3,4-tetramethylpent-1-ene (PubChem CID 178052039) has the molecular formula C21H46 and a molecular weight of 298.60 g/mol. Its IUPAC name is ethane;2-methylnonane;2,3,3,4-tetramethylpent-1-ene.
| Compound Name | ethane;2-methylnonane;2,3,3,4-tetramethylpent-1-ene |
|---|---|
| PubChem CID | 178052039 |
| Molecular Formula | C21H46 |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 298.36 |
| IUPAC Name | ethane;2-methylnonane;2,3,3,4-tetramethylpent-1-ene |
| SMILES | C=C(C)C(C)(C)C(C)C.CC.CCCCCCCC(C)C |
| InChI | InChI=1S/C10H22.C9H18.C2H6/c1-4-5-6-7-8-9-10(2)3;1-7(2)9(5,6)8(3)4;1-2/h10H,4-9H2,1-3H3;8H,1H2,2-6H3;1-2H3 |
| InChIKey | CIASXWMPFBXVDB-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|