C18H36 — CID 123271163
3-ethyl-5,7-dimethyl-5-prop-1-en-2-ylundecane (PubChem CID 123271163) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is 3-ethyl-5,7-dimethyl-5-prop-1-en-2-ylundecane.
| Compound Name | 3-ethyl-5,7-dimethyl-5-prop-1-en-2-ylundecane |
|---|---|
| PubChem CID | 123271163 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 3-ethyl-5,7-dimethyl-5-prop-1-en-2-ylundecane |
| SMILES | C=C(C)C(C)(CC(C)CCCC)CC(CC)CC |
| InChI | InChI=1S/C18H36/c1-8-11-12-16(6)13-18(7,15(4)5)14-17(9-2)10-3/h16-17H,4,8-14H2,1-3,5-7H3 |
| InChIKey | GATYUVSIFIPVRG-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|