C13H24O2 — CID 155277511
(Z)-3-ethyl-6-hydroxy-5,7,7-trimethyloct-5-en-4-one (PubChem CID 155277511) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (Z)-3-ethyl-6-hydroxy-5,7,7-trimethyloct-5-en-4-one.
| Compound Name | (Z)-3-ethyl-6-hydroxy-5,7,7-trimethyloct-5-en-4-one |
|---|---|
| PubChem CID | 155277511 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (Z)-3-ethyl-6-hydroxy-5,7,7-trimethyloct-5-en-4-one |
| SMILES | CCC(CC)C(=O)/C(C)=C(\O)C(C)(C)C |
| InChI | InChI=1S/C13H24O2/c1-7-10(8-2)11(14)9(3)12(15)13(4,5)6/h10,15H,7-8H2,1-6H3/b12-9- |
| InChIKey | GOCUEOPYVWJOFK-XFXZXTDPSA-N |
| XLogP | 3.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|