C16H33NO2 — CID 124934755
(5R,6R,8S)-5,8-diethyl-7-hydroxyiminododecan-6-ol (PubChem CID 124934755) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is (5R,6R,8S)-5,8-diethyl-7-hydroxyiminododecan-6-ol.
| Compound Name | (5R,6R,8S)-5,8-diethyl-7-hydroxyiminododecan-6-ol |
|---|---|
| PubChem CID | 124934755 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | (5R,6R,8S)-5,8-diethyl-7-hydroxyiminododecan-6-ol |
| SMILES | CCCC[C@H](CC)C(=NO)[C@H](O)[C@H](CC)CCCC |
| InChI | InChI=1S/C16H33NO2/c1-5-9-11-13(7-3)15(17-19)16(18)14(8-4)12-10-6-2/h13-14,16,18-19H,5-12H2,1-4H3/t13-,14+,16+/m0/s1 |
| InChIKey | SLCANKHLTWZHRV-SQWLQELKSA-N |
| XLogP | 4.61 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|