C13H23NO — CID 138580980
(NE)-N-(1-cyclohexyl-2,2,3-trimethylbut-3-enylidene)hydroxylamine (PubChem CID 138580980) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (NE)-N-(1-cyclohexyl-2,2,3-trimethylbut-3-enylidene)hydroxylamine.
| Compound Name | (NE)-N-(1-cyclohexyl-2,2,3-trimethylbut-3-enylidene)hydroxylamine |
|---|---|
| PubChem CID | 138580980 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (NE)-N-(1-cyclohexyl-2,2,3-trimethylbut-3-enylidene)hydroxylamine |
| SMILES | C=C(C)C(C)(C)/C(=N/O)C1CCCCC1 |
| InChI | InChI=1S/C13H23NO/c1-10(2)13(3,4)12(14-15)11-8-6-5-7-9-11/h11,15H,1,5-9H2,2-4H3/b14-12+ |
| InChIKey | GLKXBPFVICKPFW-WYMLVPIESA-N |
| XLogP | 4.00 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|