About azane;3-ethyl-2-methylpent-1-ene;hydrochloride
azane;3-ethyl-2-methylpent-1-ene;hydrochloride (PubChem CID 175344836) has the molecular formula C8H20ClN
and a molecular weight of 165.71 g/mol. Its IUPAC name is azane;3-ethyl-2-methylpent-1-ene;hydrochloride.
Molecular Properties
| Compound Name | azane;3-ethyl-2-methylpent-1-ene;hydrochloride |
| PubChem CID | 175344836 |
| Molecular Formula | C8H20ClN |
| Molecular Weight | 165.71 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | azane;3-ethyl-2-methylpent-1-ene;hydrochloride |
| SMILES | C=C(C)C(CC)CC.Cl.N |
| InChI | InChI=1S/C8H16.ClH.H3N/c1-5-8(6-2)7(3)4;;/h8H,3,5-6H2,1-2,4H3;1H;1H3 |
| InChIKey | NJUQODSSVGCFEP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;3-ethyl-2-methylpent-1-ene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-ethyl-2-methylpent-1-ene;hydrochloride?
The IUPAC name of azane;3-ethyl-2-methylpent-1-ene;hydrochloride (CID 175344836) is azane;3-ethyl-2-methylpent-1-ene;hydrochloride.
What is the SMILES notation for azane;3-ethyl-2-methylpent-1-ene;hydrochloride?
The canonical SMILES for azane;3-ethyl-2-methylpent-1-ene;hydrochloride is C=C(C)C(CC)CC.Cl.N.
What is the InChIKey of azane;3-ethyl-2-methylpent-1-ene;hydrochloride?
The InChIKey is NJUQODSSVGCFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.ClH.H3N/c1-5-8(6-2)7(3)4;;/h8H,3,5-6H2,1-2,4H3;1H;1H3.
What are the key properties of azane;3-ethyl-2-methylpent-1-ene;hydrochloride?
azane;3-ethyl-2-methylpent-1-ene;hydrochloride has a molecular weight of 165.71 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-ethyl-2-methylpent-1-ene;hydrochloride is sourced from PubChem (CID 175344836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).