C11H18 — CID 91218176
6-ethyl-7-methylocta-1,2,7-triene (PubChem CID 91218176) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 6-ethyl-7-methylocta-1,2,7-triene.
| Compound Name | 6-ethyl-7-methylocta-1,2,7-triene |
|---|---|
| PubChem CID | 91218176 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 6-ethyl-7-methylocta-1,2,7-triene |
| SMILES | C=C=CCCC(CC)C(=C)C |
| InChI | InChI=1S/C11H18/c1-5-7-8-9-11(6-2)10(3)4/h7,11H,1,3,6,8-9H2,2,4H3 |
| InChIKey | BLBREAQZXYFYQV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|