C9H16 — CID 90830179
7-methylocta-1,2-diene (PubChem CID 90830179) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is 7-methylocta-1,2-diene.
| Compound Name | 7-methylocta-1,2-diene |
|---|---|
| PubChem CID | 90830179 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 7-methylocta-1,2-diene |
| SMILES | C=C=CCCCC(C)C |
| InChI | InChI=1S/C9H16/c1-4-5-6-7-8-9(2)3/h5,9H,1,6-8H2,2-3H3 |
| InChIKey | HJUNHVGKAAMZAB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|