C18H34ClN — CID 173089642
2-methyl-N,N-bis(2-methylpent-1-en-3-yl)pent-1-en-3-amine;hydrochloride (PubChem CID 173089642) has the molecular formula C18H34ClN and a molecular weight of 299.93 g/mol. Its IUPAC name is 2-methyl-N,N-bis(2-methylpent-1-en-3-yl)pent-1-en-3-amine;hydrochloride.
| Compound Name | 2-methyl-N,N-bis(2-methylpent-1-en-3-yl)pent-1-en-3-amine;hydrochloride |
|---|---|
| PubChem CID | 173089642 |
| Molecular Formula | C18H34ClN |
| Molecular Weight | 299.93 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 2-methyl-N,N-bis(2-methylpent-1-en-3-yl)pent-1-en-3-amine;hydrochloride |
| SMILES | C=C(C)C(CC)N(C(CC)C(=C)C)C(CC)C(=C)C.Cl |
| InChI | InChI=1S/C18H33N.ClH/c1-10-16(13(4)5)19(17(11-2)14(6)7)18(12-3)15(8)9;/h16-18H,4,6,8,10-12H2,1-3,5,7,9H3;1H |
| InChIKey | RHAJQBRELIUKTF-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.93 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|