C12H23N3O2 — CID 175472051
3-(dimethylamino)-2-methylidenepentanamide;2-methylprop-2-enamide (PubChem CID 175472051) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 3-(dimethylamino)-2-methylidenepentanamide;2-methylprop-2-enamide.
| Compound Name | 3-(dimethylamino)-2-methylidenepentanamide;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 175472051 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 3-(dimethylamino)-2-methylidenepentanamide;2-methylprop-2-enamide |
| SMILES | C=C(C(N)=O)C(CC)N(C)C.C=C(C)C(N)=O |
| InChI | InChI=1S/C8H16N2O.C4H7NO/c1-5-7(10(3)4)6(2)8(9)11;1-3(2)4(5)6/h7H,2,5H2,1,3-4H3,(H2,9,11);1H2,2H3,(H2,5,6) |
| InChIKey | VMNMTDJYHIXSGC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|