About [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide
[diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide (PubChem CID 174431894) has the molecular formula C12H21NO7Si
and a molecular weight of 319.39 g/mol. Its IUPAC name is [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide.
Molecular Properties
| Compound Name | [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide |
| PubChem CID | 174431894 |
| Molecular Formula | C12H21NO7Si |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.CC[Si](OC(C)=O)(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C8H14O6Si.C4H7NO/c1-5-15(12-6(2)9,13-7(3)10)14-8(4)11;1-3(2)4(5)6/h5H2,1-4H3;1H2,2H3,(H2,5,6) |
| InChIKey | HMQUCJHDRHQCLH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide?
The IUPAC name of [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide (CID 174431894) is [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide.
What is the SMILES notation for [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide?
The canonical SMILES for [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide is C=C(C)C(N)=O.CC[Si](OC(C)=O)(OC(C)=O)OC(C)=O.
What is the InChIKey of [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide?
The InChIKey is HMQUCJHDRHQCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O6Si.C4H7NO/c1-5-15(12-6(2)9,13-7(3)10)14-8(4)11;1-3(2)4(5)6/h5H2,1-4H3;1H2,2H3,(H2,5,6).
What are the key properties of [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide?
[diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide has a molecular weight of 319.39 g/mol, XLogP of 0.68, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [diacetyloxy(ethyl)silyl] acetate;2-methylprop-2-enamide is sourced from PubChem (CID 174431894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).