About [diacetyloxy(butyl)silyl] acetate;prop-2-enamide
[diacetyloxy(butyl)silyl] acetate;prop-2-enamide (PubChem CID 158770518) has the molecular formula C13H23NO7Si
and a molecular weight of 333.41 g/mol. Its IUPAC name is [diacetyloxy(butyl)silyl] acetate;prop-2-enamide.
Molecular Properties
| Compound Name | [diacetyloxy(butyl)silyl] acetate;prop-2-enamide |
| PubChem CID | 158770518 |
| Molecular Formula | C13H23NO7Si |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [diacetyloxy(butyl)silyl] acetate;prop-2-enamide |
| SMILES | C=CC(N)=O.CCCC[Si](OC(C)=O)(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C10H18O6Si.C3H5NO/c1-5-6-7-17(14-8(2)11,15-9(3)12)16-10(4)13;1-2-3(4)5/h5-7H2,1-4H3;2H,1H2,(H2,4,5) |
| InChIKey | IPUOIISCDPQLHC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [diacetyloxy(butyl)silyl] acetate;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diacetyloxy(butyl)silyl] acetate;prop-2-enamide?
The IUPAC name of [diacetyloxy(butyl)silyl] acetate;prop-2-enamide (CID 158770518) is [diacetyloxy(butyl)silyl] acetate;prop-2-enamide.
What is the SMILES notation for [diacetyloxy(butyl)silyl] acetate;prop-2-enamide?
The canonical SMILES for [diacetyloxy(butyl)silyl] acetate;prop-2-enamide is C=CC(N)=O.CCCC[Si](OC(C)=O)(OC(C)=O)OC(C)=O.
What is the InChIKey of [diacetyloxy(butyl)silyl] acetate;prop-2-enamide?
The InChIKey is IPUOIISCDPQLHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O6Si.C3H5NO/c1-5-6-7-17(14-8(2)11,15-9(3)12)16-10(4)13;1-2-3(4)5/h5-7H2,1-4H3;2H,1H2,(H2,4,5).
What are the key properties of [diacetyloxy(butyl)silyl] acetate;prop-2-enamide?
[diacetyloxy(butyl)silyl] acetate;prop-2-enamide has a molecular weight of 333.41 g/mol, XLogP of 1.07, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [diacetyloxy(butyl)silyl] acetate;prop-2-enamide is sourced from PubChem (CID 158770518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).