C14H25N3O2 — CID 156761805
(2E,4Z)-5-[1-(dimethylamino)propyl]-3-ethyl-2-methylhexa-2,4-dienediamide (PubChem CID 156761805) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is (2E,4Z)-5-[1-(dimethylamino)propyl]-3-ethyl-2-methylhexa-2,4-dienediamide.
| Compound Name | (2E,4Z)-5-[1-(dimethylamino)propyl]-3-ethyl-2-methylhexa-2,4-dienediamide |
|---|---|
| PubChem CID | 156761805 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | (2E,4Z)-5-[1-(dimethylamino)propyl]-3-ethyl-2-methylhexa-2,4-dienediamide |
| SMILES | CCC(/C=C(\C(N)=O)C(CC)N(C)C)=C(/C)C(N)=O |
| InChI | InChI=1S/C14H25N3O2/c1-6-10(9(3)13(15)18)8-11(14(16)19)12(7-2)17(4)5/h8,12H,6-7H2,1-5H3,(H2,15,18)(H2,16,19)/b10-9+,11-8- |
| InChIKey | ACMMQJAWEXOWJK-PGGWCAKNSA-N |
| XLogP | 0.95 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|