About 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite
3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite (PubChem CID 146301735) has the molecular formula C9H20N2O4S
and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite.
Molecular Properties
| Compound Name | 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite |
| PubChem CID | 146301735 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite |
| SMILES | C=C(C(N)=O)C(CC)N(C)C.COS(=O)O |
| InChI | InChI=1S/C8H16N2O.CH4O3S/c1-5-7(10(3)4)6(2)8(9)11;1-4-5(2)3/h7H,2,5H2,1,3-4H3,(H2,9,11);1H3,(H,2,3) |
| InChIKey | CBJPFZGRRFUXOC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite?
The IUPAC name of 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite (CID 146301735) is 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite.
What is the SMILES notation for 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite?
The canonical SMILES for 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite is C=C(C(N)=O)C(CC)N(C)C.COS(=O)O.
What is the InChIKey of 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite?
The InChIKey is CBJPFZGRRFUXOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.CH4O3S/c1-5-7(10(3)4)6(2)8(9)11;1-4-5(2)3/h7H,2,5H2,1,3-4H3,(H2,9,11);1H3,(H,2,3).
What are the key properties of 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite?
3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite has a molecular weight of 252.34 g/mol, XLogP of 0.14, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-2-methylidenepentanamide;methyl hydrogen sulfite is sourced from PubChem (CID 146301735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).