C16H29N3O3 — CID 156761797
(2Z,4Z)-5-[1-(dimethylamino)propyl]-3-(1-ethoxyethyl)-2-methylhexa-2,4-dienediamide (PubChem CID 156761797) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is (2Z,4Z)-5-[1-(dimethylamino)propyl]-3-(1-ethoxyethyl)-2-methylhexa-2,4-dienediamide.
| Compound Name | (2Z,4Z)-5-[1-(dimethylamino)propyl]-3-(1-ethoxyethyl)-2-methylhexa-2,4-dienediamide |
|---|---|
| PubChem CID | 156761797 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (2Z,4Z)-5-[1-(dimethylamino)propyl]-3-(1-ethoxyethyl)-2-methylhexa-2,4-dienediamide |
| SMILES | CCOC(C)C(/C=C(\C(N)=O)C(CC)N(C)C)=C(/C)C(N)=O |
| InChI | InChI=1S/C16H29N3O3/c1-7-14(19(5)6)13(16(18)21)9-12(10(3)15(17)20)11(4)22-8-2/h9,11,14H,7-8H2,1-6H3,(H2,17,20)(H2,18,21)/b12-10-,13-9- |
| InChIKey | XDHCKEXUGMPQRD-VHRXNPEUSA-N |
| XLogP | 0.97 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|