C8H16N6O3 — CID 71396195
[[1-(carbamoylhydrazinylidene)-3-ethoxybutan-2-ylidene]amino]urea (PubChem CID 71396195) has the molecular formula C8H16N6O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is [[1-(carbamoylhydrazinylidene)-3-ethoxybutan-2-ylidene]amino]urea.
| Compound Name | [[1-(carbamoylhydrazinylidene)-3-ethoxybutan-2-ylidene]amino]urea |
|---|---|
| PubChem CID | 71396195 |
| Molecular Formula | C8H16N6O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [[1-(carbamoylhydrazinylidene)-3-ethoxybutan-2-ylidene]amino]urea |
| SMILES | CCOC(C)C(C=NNC(N)=O)=NNC(N)=O |
| InChI | InChI=1S/C8H16N6O3/c1-3-17-5(2)6(12-14-8(10)16)4-11-13-7(9)15/h4-5H,3H2,1-2H3,(H3,9,13,15)(H3,10,14,16) |
| InChIKey | JMUDXWIRQXKVIJ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|