About [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea
[[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea (PubChem CID 5380500) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea.
Molecular Properties
| Compound Name | [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea |
| PubChem CID | 5380500 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea |
| SMILES | C/C(=C/C(=NNC(N)=O)C(C)C)C(C)C |
| InChI | InChI=1S/C11H21N3O/c1-7(2)9(5)6-10(8(3)4)13-14-11(12)15/h6-8H,1-5H3,(H3,12,14,15)/b9-6-,13-10? |
| InChIKey | RZRVYNOETONNKJ-NBBFJZPZSA-N |
| XLogP | 2.27 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea?
The IUPAC name of [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea (CID 5380500) is [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea.
What is the SMILES notation for [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea?
The canonical SMILES for [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea is C/C(=C/C(=NNC(N)=O)C(C)C)C(C)C.
What is the InChIKey of [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea?
The InChIKey is RZRVYNOETONNKJ-NBBFJZPZSA-N. The full InChI is InChI=1S/C11H21N3O/c1-7(2)9(5)6-10(8(3)4)13-14-11(12)15/h6-8H,1-5H3,(H3,12,14,15)/b9-6-,13-10?.
What are the key properties of [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea?
[[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea has a molecular weight of 211.31 g/mol, XLogP of 2.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[(Z)-2,5,6-trimethylhept-4-en-3-ylidene]amino]urea is sourced from PubChem (CID 5380500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).