About butan-2-ol;2-prop-1-en-2-yloxybutane
butan-2-ol;2-prop-1-en-2-yloxybutane (PubChem CID 159582124) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is butan-2-ol;2-prop-1-en-2-yloxybutane.
Molecular Properties
| Compound Name | butan-2-ol;2-prop-1-en-2-yloxybutane |
| PubChem CID | 159582124 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | butan-2-ol;2-prop-1-en-2-yloxybutane |
| SMILES | C=C(C)OC(C)CC.CCC(C)O |
| InChI | InChI=1S/C7H14O.C4H10O/c1-5-7(4)8-6(2)3;1-3-4(2)5/h7H,2,5H2,1,3-4H3;4-5H,3H2,1-2H3 |
| InChIKey | MJDOGGKSNWOFEW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ol;2-prop-1-en-2-yloxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;2-prop-1-en-2-yloxybutane?
The IUPAC name of butan-2-ol;2-prop-1-en-2-yloxybutane (CID 159582124) is butan-2-ol;2-prop-1-en-2-yloxybutane.
What is the SMILES notation for butan-2-ol;2-prop-1-en-2-yloxybutane?
The canonical SMILES for butan-2-ol;2-prop-1-en-2-yloxybutane is C=C(C)OC(C)CC.CCC(C)O.
What is the InChIKey of butan-2-ol;2-prop-1-en-2-yloxybutane?
The InChIKey is MJDOGGKSNWOFEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C4H10O/c1-5-7(4)8-6(2)3;1-3-4(2)5/h7H,2,5H2,1,3-4H3;4-5H,3H2,1-2H3.
What are the key properties of butan-2-ol;2-prop-1-en-2-yloxybutane?
butan-2-ol;2-prop-1-en-2-yloxybutane has a molecular weight of 188.31 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;2-prop-1-en-2-yloxybutane is sourced from PubChem (CID 159582124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).