About 2-amino-N'-hydroxybutanimidamide
2-amino-N'-hydroxybutanimidamide (PubChem CID 14024494) has the molecular formula C4H11N3O
and a molecular weight of 117.15 g/mol. Its IUPAC name is 2-amino-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 2-amino-N'-hydroxybutanimidamide |
| PubChem CID | 14024494 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | 2-amino-N'-hydroxybutanimidamide |
| SMILES | CCC(N)/C(N)=N/O |
| InChI | InChI=1S/C4H11N3O/c1-2-3(5)4(6)7-8/h3,8H,2,5H2,1H3,(H2,6,7) |
| InChIKey | YGGDZWDHUYCJOV-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-hydroxybutanimidamide?
The IUPAC name of 2-amino-N'-hydroxybutanimidamide (CID 14024494) is 2-amino-N'-hydroxybutanimidamide.
What is the SMILES notation for 2-amino-N'-hydroxybutanimidamide?
The canonical SMILES for 2-amino-N'-hydroxybutanimidamide is CCC(N)/C(N)=N/O.
What is the InChIKey of 2-amino-N'-hydroxybutanimidamide?
The InChIKey is YGGDZWDHUYCJOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O/c1-2-3(5)4(6)7-8/h3,8H,2,5H2,1H3,(H2,6,7).
What are the key properties of 2-amino-N'-hydroxybutanimidamide?
2-amino-N'-hydroxybutanimidamide has a molecular weight of 117.15 g/mol, XLogP of -0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-hydroxybutanimidamide is sourced from PubChem (CID 14024494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).