C6H16N4O — CID 83015704
2-(2,2-dimethylhydrazinyl)-N'-hydroxybutanimidamide (PubChem CID 83015704) has the molecular formula C6H16N4O and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-(2,2-dimethylhydrazinyl)-N'-hydroxybutanimidamide.
| Compound Name | 2-(2,2-dimethylhydrazinyl)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 83015704 |
| Molecular Formula | C6H16N4O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 2-(2,2-dimethylhydrazinyl)-N'-hydroxybutanimidamide |
| SMILES | CCC(NN(C)C)C(N)=NO |
| InChI | InChI=1S/C6H16N4O/c1-4-5(6(7)9-11)8-10(2)3/h5,8,11H,4H2,1-3H3,(H2,7,9) |
| InChIKey | KWVFWLAXCVBDPI-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|