C10H12Br3N3O — CID 77029373
N'-hydroxy-2-(2,4,6-tribromoanilino)butanimidamide (PubChem CID 77029373) has the molecular formula C10H12Br3N3O and a molecular weight of 429.94 g/mol. Its IUPAC name is N'-hydroxy-2-(2,4,6-tribromoanilino)butanimidamide.
| Compound Name | N'-hydroxy-2-(2,4,6-tribromoanilino)butanimidamide |
|---|---|
| PubChem CID | 77029373 |
| Molecular Formula | C10H12Br3N3O |
| Molecular Weight | 429.94 g/mol |
| Exact Mass | 426.85 |
| IUPAC Name | N'-hydroxy-2-(2,4,6-tribromoanilino)butanimidamide |
| SMILES | CCC(Nc1c(Br)cc(Br)cc1Br)C(N)=NO |
| InChI | InChI=1S/C10H12Br3N3O/c1-2-8(10(14)16-17)15-9-6(12)3-5(11)4-7(9)13/h3-4,8,15,17H,2H2,1H3,(H2,14,16) |
| InChIKey | CQMIVDQIGFHYGU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.94 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|