C11H13Br2N3O2 — CID 114375216
N-[(1Z)-1-amino-1-hydroxyiminobutan-2-yl]-2,5-dibromobenzamide (PubChem CID 114375216) has the molecular formula C11H13Br2N3O2 and a molecular weight of 379.05 g/mol. Its IUPAC name is N-[(1Z)-1-amino-1-hydroxyiminobutan-2-yl]-2,5-dibromobenzamide.
| Compound Name | N-[(1Z)-1-amino-1-hydroxyiminobutan-2-yl]-2,5-dibromobenzamide |
|---|---|
| PubChem CID | 114375216 |
| Molecular Formula | C11H13Br2N3O2 |
| Molecular Weight | 379.05 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | N-[(1Z)-1-amino-1-hydroxyiminobutan-2-yl]-2,5-dibromobenzamide |
| SMILES | CCC(NC(=O)c1cc(Br)ccc1Br)/C(N)=N/O |
| InChI | InChI=1S/C11H13Br2N3O2/c1-2-9(10(14)16-18)15-11(17)7-5-6(12)3-4-8(7)13/h3-5,9,18H,2H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | XVWVFSPKLKFUHM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.05 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|