C8H19N3O — CID 77025273
N'-hydroxy-2-(2-methylpropylamino)butanimidamide (PubChem CID 77025273) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is N'-hydroxy-2-(2-methylpropylamino)butanimidamide.
| Compound Name | N'-hydroxy-2-(2-methylpropylamino)butanimidamide |
|---|---|
| PubChem CID | 77025273 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | N'-hydroxy-2-(2-methylpropylamino)butanimidamide |
| SMILES | CCC(NCC(C)C)C(N)=NO |
| InChI | InChI=1S/C8H19N3O/c1-4-7(8(9)11-12)10-5-6(2)3/h6-7,10,12H,4-5H2,1-3H3,(H2,9,11) |
| InChIKey | HZDYOOJGYXLBGK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|