C8H19N3O3 — CID 77030893
N'-hydroxy-2-[(2-hydroxy-3-methoxypropyl)amino]butanimidamide (PubChem CID 77030893) has the molecular formula C8H19N3O3 and a molecular weight of 205.26 g/mol. Its IUPAC name is N'-hydroxy-2-[(2-hydroxy-3-methoxypropyl)amino]butanimidamide.
| Compound Name | N'-hydroxy-2-[(2-hydroxy-3-methoxypropyl)amino]butanimidamide |
|---|---|
| PubChem CID | 77030893 |
| Molecular Formula | C8H19N3O3 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | N'-hydroxy-2-[(2-hydroxy-3-methoxypropyl)amino]butanimidamide |
| SMILES | CCC(NCC(O)COC)C(N)=NO |
| InChI | InChI=1S/C8H19N3O3/c1-3-7(8(9)11-13)10-4-6(12)5-14-2/h6-7,10,12-13H,3-5H2,1-2H3,(H2,9,11) |
| InChIKey | GKRCJWHRLJHXFS-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|