C9H17N3OS — CID 106429178
N'-hydroxy-2-(2-prop-2-ynylsulfanylethylamino)butanimidamide (PubChem CID 106429178) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is N'-hydroxy-2-(2-prop-2-ynylsulfanylethylamino)butanimidamide.
| Compound Name | N'-hydroxy-2-(2-prop-2-ynylsulfanylethylamino)butanimidamide |
|---|---|
| PubChem CID | 106429178 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N'-hydroxy-2-(2-prop-2-ynylsulfanylethylamino)butanimidamide |
| SMILES | C#CCSCCNC(CC)C(N)=NO |
| InChI | InChI=1S/C9H17N3OS/c1-3-6-14-7-5-11-8(4-2)9(10)12-13/h1,8,11,13H,4-7H2,2H3,(H2,10,12) |
| InChIKey | MITDZTAMJKKNAU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|