C6H14N2OS — CID 43369057
3-ethylsulfanyl-N'-hydroxy-2-methylpropanimidamide (PubChem CID 43369057) has the molecular formula C6H14N2OS and a molecular weight of 162.26 g/mol. Its IUPAC name is 3-ethylsulfanyl-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-ethylsulfanyl-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 43369057 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-ethylsulfanyl-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CCSCC(C)/C(N)=N/O |
| InChI | InChI=1S/C6H14N2OS/c1-3-10-4-5(2)6(7)8-9/h5,9H,3-4H2,1-2H3,(H2,7,8) |
| InChIKey | MCKUKHPBWFDFEW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|