C11H25N3O — CID 82927481
3-[2-ethylbutyl(methyl)amino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 82927481) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-[2-ethylbutyl(methyl)amino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[2-ethylbutyl(methyl)amino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 82927481 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 3-[2-ethylbutyl(methyl)amino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CCC(CC)CN(C)CC(C)C(N)=NO |
| InChI | InChI=1S/C11H25N3O/c1-5-10(6-2)8-14(4)7-9(3)11(12)13-15/h9-10,15H,5-8H2,1-4H3,(H2,12,13) |
| InChIKey | HBEOVBPIXPEHDV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|