C10H16BrN3OS — CID 76910061
3-[(5-bromothiophen-3-yl)methyl-methylamino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 76910061) has the molecular formula C10H16BrN3OS and a molecular weight of 306.23 g/mol. Its IUPAC name is 3-[(5-bromothiophen-3-yl)methyl-methylamino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[(5-bromothiophen-3-yl)methyl-methylamino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 76910061 |
| Molecular Formula | C10H16BrN3OS |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 3-[(5-bromothiophen-3-yl)methyl-methylamino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CC(CN(C)Cc1csc(Br)c1)C(N)=NO |
| InChI | InChI=1S/C10H16BrN3OS/c1-7(10(12)13-15)4-14(2)5-8-3-9(11)16-6-8/h3,6-7,15H,4-5H2,1-2H3,(H2,12,13) |
| InChIKey | RLQLKPAKMGOXDM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|