C9H21N3O — CID 43272171
N'-hydroxy-2-methyl-3-[methyl(2-methylpropyl)amino]propanimidamide (PubChem CID 43272171) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-3-[methyl(2-methylpropyl)amino]propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-3-[methyl(2-methylpropyl)amino]propanimidamide |
|---|---|
| PubChem CID | 43272171 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | N'-hydroxy-2-methyl-3-[methyl(2-methylpropyl)amino]propanimidamide |
| SMILES | CC(C)CN(C)CC(C)/C(N)=N/O |
| InChI | InChI=1S/C9H21N3O/c1-7(2)5-12(4)6-8(3)9(10)11-13/h7-8,13H,5-6H2,1-4H3,(H2,10,11) |
| InChIKey | CBABOIMSLVJPNQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|