C9H13BrClNOS — CID 112561425
1-[(5-bromothiophen-3-yl)methyl-methylamino]-3-chloropropan-2-ol (PubChem CID 112561425) has the molecular formula C9H13BrClNOS and a molecular weight of 298.63 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methyl-methylamino]-3-chloropropan-2-ol.
| Compound Name | 1-[(5-bromothiophen-3-yl)methyl-methylamino]-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 112561425 |
| Molecular Formula | C9H13BrClNOS |
| Molecular Weight | 298.63 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methyl-methylamino]-3-chloropropan-2-ol |
| SMILES | CN(Cc1csc(Br)c1)CC(O)CCl |
| InChI | InChI=1S/C9H13BrClNOS/c1-12(5-8(13)3-11)4-7-2-9(10)14-6-7/h2,6,8,13H,3-5H2,1H3 |
| InChIKey | JNPGDIUBIKQLAF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.63 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|