C11H15ClFNO — CID 112561328
1-chloro-3-[(4-fluorophenyl)methyl-methylamino]propan-2-ol (PubChem CID 112561328) has the molecular formula C11H15ClFNO and a molecular weight of 231.70 g/mol. Its IUPAC name is 1-chloro-3-[(4-fluorophenyl)methyl-methylamino]propan-2-ol.
| Compound Name | 1-chloro-3-[(4-fluorophenyl)methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 112561328 |
| Molecular Formula | C11H15ClFNO |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-chloro-3-[(4-fluorophenyl)methyl-methylamino]propan-2-ol |
| SMILES | CN(Cc1ccc(F)cc1)CC(O)CCl |
| InChI | InChI=1S/C11H15ClFNO/c1-14(8-11(15)6-12)7-9-2-4-10(13)5-3-9/h2-5,11,15H,6-8H2,1H3 |
| InChIKey | FMYLOUYFXCHFJA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|