C16H19FN2O — CID 62266116
1-(2-aminophenyl)-2-[(4-fluorophenyl)methyl-methylamino]ethanol (PubChem CID 62266116) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(2-aminophenyl)-2-[(4-fluorophenyl)methyl-methylamino]ethanol.
| Compound Name | 1-(2-aminophenyl)-2-[(4-fluorophenyl)methyl-methylamino]ethanol |
|---|---|
| PubChem CID | 62266116 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-(2-aminophenyl)-2-[(4-fluorophenyl)methyl-methylamino]ethanol |
| SMILES | CN(Cc1ccc(F)cc1)CC(O)c1ccccc1N |
| InChI | InChI=1S/C16H19FN2O/c1-19(10-12-6-8-13(17)9-7-12)11-16(20)14-4-2-3-5-15(14)18/h2-9,16,20H,10-11,18H2,1H3 |
| InChIKey | GBZIZONUJARJIC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|