C10H14BrNOS — CID 62039108
1-[(5-bromothiophen-3-yl)methyl-methylamino]butan-2-one (PubChem CID 62039108) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methyl-methylamino]butan-2-one.
| Compound Name | 1-[(5-bromothiophen-3-yl)methyl-methylamino]butan-2-one |
|---|---|
| PubChem CID | 62039108 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methyl-methylamino]butan-2-one |
| SMILES | CCC(=O)CN(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C10H14BrNOS/c1-3-9(13)6-12(2)5-8-4-10(11)14-7-8/h4,7H,3,5-6H2,1-2H3 |
| InChIKey | QFMFJQIAHVANFK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |