C12H19BrN2S — CID 103069893
N-[(5-bromothiophen-3-yl)methyl]-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine (PubChem CID 103069893) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine |
|---|---|
| PubChem CID | 103069893 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine |
| SMILES | C=C(CNCC)CN(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C12H19BrN2S/c1-4-14-6-10(2)7-15(3)8-11-5-12(13)16-9-11/h5,9,14H,2,4,6-8H2,1,3H3 |
| InChIKey | MJLSWDGWWUQORT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|