C10H14BrF3N2S — CID 62557186
N'-[(5-bromothiophen-3-yl)methyl]-N'-methyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 62557186) has the molecular formula C10H14BrF3N2S and a molecular weight of 331.20 g/mol. Its IUPAC name is N'-[(5-bromothiophen-3-yl)methyl]-N'-methyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | N'-[(5-bromothiophen-3-yl)methyl]-N'-methyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62557186 |
| Molecular Formula | C10H14BrF3N2S |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | N'-[(5-bromothiophen-3-yl)methyl]-N'-methyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CN(CCNCC(F)(F)F)Cc1csc(Br)c1 |
| InChI | InChI=1S/C10H14BrF3N2S/c1-16(3-2-15-7-10(12,13)14)5-8-4-9(11)17-6-8/h4,6,15H,2-3,5,7H2,1H3 |
| InChIKey | JFXLGCMYSBGDMO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|