About N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine)
N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine) (PubChem CID 173363493) has the molecular formula C16H37N3O3Si
and a molecular weight of 347.58 g/mol. Its IUPAC name is N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine).
Molecular Properties
| Compound Name | N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine) |
| PubChem CID | 173363493 |
| Molecular Formula | C16H37N3O3Si |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine) |
| SMILES | CC(C)C(C)C([SiH3])=NO.CC(C)CC=NO.CC(C)CC=NO |
| InChI | InChI=1S/C6H15NOSi.2C5H11NO/c1-4(2)5(3)6(9)7-8;2*1-5(2)3-4-6-7/h4-5,8H,1-3,9H3;2*4-5,7H,3H2,1-2H3 |
| InChIKey | WXYFHXZYMMPEKO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine)?
The IUPAC name of N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine) (CID 173363493) is N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine).
What is the SMILES notation for N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine)?
The canonical SMILES for N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine) is CC(C)C(C)C([SiH3])=NO.CC(C)CC=NO.CC(C)CC=NO.
What is the InChIKey of N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine)?
The InChIKey is WXYFHXZYMMPEKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NOSi.2C5H11NO/c1-4(2)5(3)6(9)7-8;2*1-5(2)3-4-6-7/h4-5,8H,1-3,9H3;2*4-5,7H,3H2,1-2H3.
What are the key properties of N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine)?
N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine) has a molecular weight of 347.58 g/mol, XLogP of 3.42, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dimethyl-1-silylbutylidene)hydroxylamine;bis(N-(3-methylbutylidene)hydroxylamine) is sourced from PubChem (CID 173363493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).