C7H14N2O3 — CID 118374581
(3S,4R,6E)-3-hydroxy-6-hydroxyimino-4-methylhexanamide (PubChem CID 118374581) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is (3S,4R,6E)-3-hydroxy-6-hydroxyimino-4-methylhexanamide.
| Compound Name | (3S,4R,6E)-3-hydroxy-6-hydroxyimino-4-methylhexanamide |
|---|---|
| PubChem CID | 118374581 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (3S,4R,6E)-3-hydroxy-6-hydroxyimino-4-methylhexanamide |
| SMILES | C[C@H](C/C=N/O)[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C7H14N2O3/c1-5(2-3-9-12)6(10)4-7(8)11/h3,5-6,10,12H,2,4H2,1H3,(H2,8,11)/b9-3+/t5-,6+/m1/s1 |
| InChIKey | SUBPRHOBBRTYSV-JJUSWOCESA-N |
| XLogP | -0.29 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|