C7H13NO3 — CID 118374709
(3S,4R)-3-hydroxy-4-methyl-6-oxohexanamide (PubChem CID 118374709) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-4-methyl-6-oxohexanamide.
| Compound Name | (3S,4R)-3-hydroxy-4-methyl-6-oxohexanamide |
|---|---|
| PubChem CID | 118374709 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (3S,4R)-3-hydroxy-4-methyl-6-oxohexanamide |
| SMILES | C[C@H](CC=O)[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C7H13NO3/c1-5(2-3-9)6(10)4-7(8)11/h3,5-6,10H,2,4H2,1H3,(H2,8,11)/t5-,6+/m1/s1 |
| InChIKey | GYCKTRAJVNXSHJ-RITPCOANSA-N |
| XLogP | -0.55 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|