About alumane;1,1-dichloro-2-methylpropane
alumane;1,1-dichloro-2-methylpropane (PubChem CID 173060987) has the molecular formula C4H11AlCl2
and a molecular weight of 157.02 g/mol. Its IUPAC name is alumane;1,1-dichloro-2-methylpropane.
Molecular Properties
| Compound Name | alumane;1,1-dichloro-2-methylpropane |
| PubChem CID | 173060987 |
| Molecular Formula | C4H11AlCl2 |
| Molecular Weight | 157.02 g/mol |
| Exact Mass | 156.01 |
| IUPAC Name | alumane;1,1-dichloro-2-methylpropane |
| SMILES | CC(C)C(Cl)Cl.[AlH3] |
| InChI | InChI=1S/C4H8Cl2.Al.3H/c1-3(2)4(5)6;;;;/h3-4H,1-2H3;;;; |
| InChIKey | NMFUBRJJTLLEBU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.02 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze alumane;1,1-dichloro-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;1,1-dichloro-2-methylpropane?
The IUPAC name of alumane;1,1-dichloro-2-methylpropane (CID 173060987) is alumane;1,1-dichloro-2-methylpropane.
What is the SMILES notation for alumane;1,1-dichloro-2-methylpropane?
The canonical SMILES for alumane;1,1-dichloro-2-methylpropane is CC(C)C(Cl)Cl.[AlH3].
What is the InChIKey of alumane;1,1-dichloro-2-methylpropane?
The InChIKey is NMFUBRJJTLLEBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8Cl2.Al.3H/c1-3(2)4(5)6;;;;/h3-4H,1-2H3;;;;.
What are the key properties of alumane;1,1-dichloro-2-methylpropane?
alumane;1,1-dichloro-2-methylpropane has a molecular weight of 157.02 g/mol, XLogP of 1.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;1,1-dichloro-2-methylpropane is sourced from PubChem (CID 173060987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).