About 1,1-dichloroethane;trichlorosilane
1,1-dichloroethane;trichlorosilane (PubChem CID 173310678) has the molecular formula C2H5Cl5Si
and a molecular weight of 234.41 g/mol. Its IUPAC name is 1,1-dichloroethane;trichlorosilane.
Molecular Properties
| Compound Name | 1,1-dichloroethane;trichlorosilane |
| PubChem CID | 173310678 |
| Molecular Formula | C2H5Cl5Si |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 231.86 |
| IUPAC Name | 1,1-dichloroethane;trichlorosilane |
| SMILES | CC(Cl)Cl.Cl[SiH](Cl)Cl |
| InChI | InChI=1S/C2H4Cl2.Cl3HSi/c1-2(3)4;1-4(2)3/h2H,1H3;4H |
| InChIKey | AGDUDEDCFGZWES-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloroethane;trichlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloroethane;trichlorosilane?
The IUPAC name of 1,1-dichloroethane;trichlorosilane (CID 173310678) is 1,1-dichloroethane;trichlorosilane.
What is the SMILES notation for 1,1-dichloroethane;trichlorosilane?
The canonical SMILES for 1,1-dichloroethane;trichlorosilane is CC(Cl)Cl.Cl[SiH](Cl)Cl.
What is the InChIKey of 1,1-dichloroethane;trichlorosilane?
The InChIKey is AGDUDEDCFGZWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Cl2.Cl3HSi/c1-2(3)4;1-4(2)3/h2H,1H3;4H.
What are the key properties of 1,1-dichloroethane;trichlorosilane?
1,1-dichloroethane;trichlorosilane has a molecular weight of 234.41 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloroethane;trichlorosilane is sourced from PubChem (CID 173310678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).