C4H12Cl2N2 — CID 157169492
1,1-dichloroethane;1,2-dimethylhydrazine (PubChem CID 157169492) has the molecular formula C4H12Cl2N2 and a molecular weight of 159.06 g/mol. Its IUPAC name is 1,1-dichloroethane;1,2-dimethylhydrazine.
| Compound Name | 1,1-dichloroethane;1,2-dimethylhydrazine |
|---|---|
| PubChem CID | 157169492 |
| Molecular Formula | C4H12Cl2N2 |
| Molecular Weight | 159.06 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 1,1-dichloroethane;1,2-dimethylhydrazine |
| SMILES | CC(Cl)Cl.CNNC |
| InChI | InChI=1S/C2H4Cl2.C2H8N2/c1-2(3)4;1-3-4-2/h2H,1H3;3-4H,1-2H3 |
| InChIKey | ANHIFNIDTQSOBV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.06 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|