C5H11NO3 — CID 14893824
(NE)-N-(1,1-dimethoxypropan-2-ylidene)hydroxylamine (PubChem CID 14893824) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is (NE)-N-(1,1-dimethoxypropan-2-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(1,1-dimethoxypropan-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 14893824 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (NE)-N-(1,1-dimethoxypropan-2-ylidene)hydroxylamine |
| SMILES | COC(OC)/C(C)=N/O |
| InChI | InChI=1S/C5H11NO3/c1-4(6-7)5(8-2)9-3/h5,7H,1-3H3/b6-4+ |
| InChIKey | WIBYEQIPBJRAPV-GQCTYLIASA-N |
| XLogP | 0.46 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|