About 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one
2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one (PubChem CID 161372336) has the molecular formula C10H20O6
and a molecular weight of 236.26 g/mol. Its IUPAC name is 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one.
Molecular Properties
| Compound Name | 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one |
| PubChem CID | 161372336 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one |
| SMILES | COC(C)(C=O)OC.COC(OC)C(C)=O |
| InChI | InChI=1S/2C5H10O3/c1-5(4-6,7-2)8-3;1-4(6)5(7-2)8-3/h4H,1-3H3;5H,1-3H3 |
| InChIKey | VQPXFAOKRVNYLV-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one?
The IUPAC name of 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one (CID 161372336) is 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one.
What is the SMILES notation for 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one?
The canonical SMILES for 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one is COC(C)(C=O)OC.COC(OC)C(C)=O.
What is the InChIKey of 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one?
The InChIKey is VQPXFAOKRVNYLV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H10O3/c1-5(4-6,7-2)8-3;1-4(6)5(7-2)8-3/h4H,1-3H3;5H,1-3H3.
What are the key properties of 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one?
2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one has a molecular weight of 236.26 g/mol, XLogP of 0.39, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one is sourced from PubChem (CID 161372336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).