C10H20O6 — CID 161372336
2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one (PubChem CID 161372336) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one.
| Compound Name | 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one |
|---|---|
| PubChem CID | 161372336 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2,2-dimethoxypropanal;1,1-dimethoxypropan-2-one |
| SMILES | COC(C)(C=O)OC.COC(OC)C(C)=O |
| InChI | InChI=1S/2C5H10O3/c1-5(4-6,7-2)8-3;1-4(6)5(7-2)8-3/h4H,1-3H3;5H,1-3H3 |
| InChIKey | VQPXFAOKRVNYLV-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|