C16H31NO5 — CID 157326609
N-cyclohexyl-1,1-dimethoxypropan-2-imine;1,1-dimethoxypropan-2-one (PubChem CID 157326609) has the molecular formula C16H31NO5 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-cyclohexyl-1,1-dimethoxypropan-2-imine;1,1-dimethoxypropan-2-one.
| Compound Name | N-cyclohexyl-1,1-dimethoxypropan-2-imine;1,1-dimethoxypropan-2-one |
|---|---|
| PubChem CID | 157326609 |
| Molecular Formula | C16H31NO5 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | N-cyclohexyl-1,1-dimethoxypropan-2-imine;1,1-dimethoxypropan-2-one |
| SMILES | COC(OC)/C(C)=N/C1CCCCC1.COC(OC)C(C)=O |
| InChI | InChI=1S/C11H21NO2.C5H10O3/c1-9(11(13-2)14-3)12-10-7-5-4-6-8-10;1-4(6)5(7-2)8-3/h10-11H,4-8H2,1-3H3;5H,1-3H3/b12-9+; |
| InChIKey | BEULFUKMZKIBLM-NBYYMMLRSA-N |
| XLogP | 2.59 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|