C26H44N4O2 — CID 54169753
3-cyclohexylimino-N-[4-(3-cyclohexyliminobutanoylamino)cyclohexyl]butanamide (PubChem CID 54169753) has the molecular formula C26H44N4O2 and a molecular weight of 444.66 g/mol. Its IUPAC name is 3-cyclohexylimino-N-[4-(3-cyclohexyliminobutanoylamino)cyclohexyl]butanamide.
| Compound Name | 3-cyclohexylimino-N-[4-(3-cyclohexyliminobutanoylamino)cyclohexyl]butanamide |
|---|---|
| PubChem CID | 54169753 |
| Molecular Formula | C26H44N4O2 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | 3-cyclohexylimino-N-[4-(3-cyclohexyliminobutanoylamino)cyclohexyl]butanamide |
| SMILES | C/C(CC(=O)NC1CCC(NC(=O)C/C(C)=N/C2CCCCC2)CC1)=N\C1CCCCC1 |
| InChI | InChI=1S/C26H44N4O2/c1-19(27-21-9-5-3-6-10-21)17-25(31)29-23-13-15-24(16-14-23)30-26(32)18-20(2)28-22-11-7-4-8-12-22/h21-24H,3-18H2,1-2H3,(H,29,31)(H,30,32)/b27-19+,28-20+ |
| InChIKey | OUEJZXIGRMEHHG-MKYUKRCKSA-N |
| XLogP | 4.90 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|