About (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate
(propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate (PubChem CID 86664643) has the molecular formula C18H31N3O2
and a molecular weight of 321.47 g/mol. Its IUPAC name is (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate |
| PubChem CID | 86664643 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate |
| SMILES | CC(=O)N(/C(=N/C1CCCCC1)ON=C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C18H31N3O2/c1-14(2)20-23-18(19-16-10-6-4-7-11-16)21(15(3)22)17-12-8-5-9-13-17/h16-17H,4-13H2,1-3H3/b19-18- |
| InChIKey | RVQYFTJAXMGPNS-HNENSFHCSA-N |
| XLogP | 4.27 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate?
The IUPAC name of (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate (CID 86664643) is (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate.
What is the SMILES notation for (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate?
The canonical SMILES for (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate is CC(=O)N(/C(=N/C1CCCCC1)ON=C(C)C)C1CCCCC1.
What is the InChIKey of (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate?
The InChIKey is RVQYFTJAXMGPNS-HNENSFHCSA-N. The full InChI is InChI=1S/C18H31N3O2/c1-14(2)20-23-18(19-16-10-6-4-7-11-16)21(15(3)22)17-12-8-5-9-13-17/h16-17H,4-13H2,1-3H3/b19-18-.
What are the key properties of (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate?
(propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate has a molecular weight of 321.47 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) N-acetyl-N,N'-dicyclohexylcarbamimidate is sourced from PubChem (CID 86664643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).