N-cyclohexylethanimidoyl fluoride

C8H14FN — CID 24977694

IUPACN-cyclohexylethanimidoyl fluoride
SMILESC/C(F)=N\C1CCCCC1
InChIInChI=1S/C8H14FN/c1-7(9)10-8-5-3-2-4-6-8/h8H,2-6H2,1H3/b10-7+
InChIKeyFKDPDXIXDRMVJX-JXMROGBWSA-N
MW143.21 g/mol
LogP2.71
Rot. Bonds1

About N-cyclohexylethanimidoyl fluoride

N-cyclohexylethanimidoyl fluoride (PubChem CID 24977694) has the molecular formula C8H14FN and a molecular weight of 143.21 g/mol. Its IUPAC name is N-cyclohexylethanimidoyl fluoride.

Molecular Properties

Compound NameN-cyclohexylethanimidoyl fluoride
PubChem CID24977694
Molecular FormulaC8H14FN
Molecular Weight143.21 g/mol
Exact Mass143.11
IUPAC NameN-cyclohexylethanimidoyl fluoride
SMILESC/C(F)=N\C1CCCCC1
InChIInChI=1S/C8H14FN/c1-7(9)10-8-5-3-2-4-6-8/h8H,2-6H2,1H3/b10-7+
InChIKeyFKDPDXIXDRMVJX-JXMROGBWSA-N
XLogP2.71
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.21
LogP ≤ 52.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze N-cyclohexylethanimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-cyclohexylethanimidoyl fluoride?
The IUPAC name of N-cyclohexylethanimidoyl fluoride (CID 24977694) is N-cyclohexylethanimidoyl fluoride.
What is the SMILES notation for N-cyclohexylethanimidoyl fluoride?
The canonical SMILES for N-cyclohexylethanimidoyl fluoride is C/C(F)=N\C1CCCCC1.
What is the InChIKey of N-cyclohexylethanimidoyl fluoride?
The InChIKey is FKDPDXIXDRMVJX-JXMROGBWSA-N. The full InChI is InChI=1S/C8H14FN/c1-7(9)10-8-5-3-2-4-6-8/h8H,2-6H2,1H3/b10-7+.
What are the key properties of N-cyclohexylethanimidoyl fluoride?
N-cyclohexylethanimidoyl fluoride has a molecular weight of 143.21 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylethanimidoyl fluoride is sourced from PubChem (CID 24977694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).