About N-cyclohexylethanimidoyl fluoride
N-cyclohexylethanimidoyl fluoride (PubChem CID 24977694) has the molecular formula C8H14FN
and a molecular weight of 143.21 g/mol. Its IUPAC name is N-cyclohexylethanimidoyl fluoride.
Molecular Properties
| Compound Name | N-cyclohexylethanimidoyl fluoride |
| PubChem CID | 24977694 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | N-cyclohexylethanimidoyl fluoride |
| SMILES | C/C(F)=N\C1CCCCC1 |
| InChI | InChI=1S/C8H14FN/c1-7(9)10-8-5-3-2-4-6-8/h8H,2-6H2,1H3/b10-7+ |
| InChIKey | FKDPDXIXDRMVJX-JXMROGBWSA-N |
| XLogP | 2.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylethanimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylethanimidoyl fluoride?
The IUPAC name of N-cyclohexylethanimidoyl fluoride (CID 24977694) is N-cyclohexylethanimidoyl fluoride.
What is the SMILES notation for N-cyclohexylethanimidoyl fluoride?
The canonical SMILES for N-cyclohexylethanimidoyl fluoride is C/C(F)=N\C1CCCCC1.
What is the InChIKey of N-cyclohexylethanimidoyl fluoride?
The InChIKey is FKDPDXIXDRMVJX-JXMROGBWSA-N. The full InChI is InChI=1S/C8H14FN/c1-7(9)10-8-5-3-2-4-6-8/h8H,2-6H2,1H3/b10-7+.
What are the key properties of N-cyclohexylethanimidoyl fluoride?
N-cyclohexylethanimidoyl fluoride has a molecular weight of 143.21 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylethanimidoyl fluoride is sourced from PubChem (CID 24977694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).