C14H27NO2 — CID 71383098
N-cyclohexyl-1,1-dimethoxy-4-methylpentan-2-imine (PubChem CID 71383098) has the molecular formula C14H27NO2 and a molecular weight of 241.38 g/mol. Its IUPAC name is N-cyclohexyl-1,1-dimethoxy-4-methylpentan-2-imine.
| Compound Name | N-cyclohexyl-1,1-dimethoxy-4-methylpentan-2-imine |
|---|---|
| PubChem CID | 71383098 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | N-cyclohexyl-1,1-dimethoxy-4-methylpentan-2-imine |
| SMILES | COC(OC)/C(CC(C)C)=N/C1CCCCC1 |
| InChI | InChI=1S/C14H27NO2/c1-11(2)10-13(14(16-3)17-4)15-12-8-6-5-7-9-12/h11-12,14H,5-10H2,1-4H3/b15-13+ |
| InChIKey | HZNXYYJYFGFRHT-FYWRMAATSA-N |
| XLogP | 3.43 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|