C16H30N2O — CID 10945389
propan-2-yl N,N'-dicyclohexylcarbamimidate (PubChem CID 10945389) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is propan-2-yl N,N'-dicyclohexylcarbamimidate.
| Compound Name | propan-2-yl N,N'-dicyclohexylcarbamimidate |
|---|---|
| PubChem CID | 10945389 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | propan-2-yl N,N'-dicyclohexylcarbamimidate |
| SMILES | CC(C)O/C(=N/C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C16H30N2O/c1-13(2)19-16(17-14-9-5-3-6-10-14)18-15-11-7-4-8-12-15/h13-15H,3-12H2,1-2H3,(H,17,18) |
| InChIKey | ULSDVOVRMGDHBZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|